For research use only. Not for therapeutic Use.
Sorbic Acid(Cat No.:R015407)is a widely used organic compound in the food and pharmaceutical industries as a preservative. Its primary function is to inhibit the growth of molds, yeasts, and fungi, thereby extending the shelf life of various products. Sorbic Acid is particularly effective in acidic conditions and is commonly found in baked goods, beverages, and cosmetics. Additionally, it plays a role in pharmaceutical formulations, preventing microbial contamination in topical creams, ointments, and other preparations. Its safety and effectiveness make it a standard preservative in many consumer products.
CAS Number | 110-44-1 |
Synonyms | Sorbic Acid; (2E,4E)-2,4-Hexadienoic Acid; (E,E)-1,3-Pentadiene-1-carboxylic Acid; (E,E)-2,4-Hexadienoic Acid; 2E,4E-Hexadienoic Acid; E 200; NSC 35405; NSC 49103; NSC 50268; Panosorb; SO 215; Sorbinic Acid; Sorbistat; trans,trans-2,4-Hexadienoic Aci |
Molecular Formula | C6H8O2 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Storage | Desiccate at RT |
IUPAC Name | (2E,4E)-hexa-2,4-dienoic acid |
InChI | InChI=1S/C6H8O2/c1-2-3-4-5-6(7)8/h2-5H,1H3,(H,7,8)/b3-2+,5-4+ |
InChIKey | WSWCOQWTEOXDQX-MQQKCMAXSA-N |
SMILES | C/C=C/C=C/C(=O)O |