For research use only. Not for therapeutic Use.
Sotalol(CAT: I011422) is a medication used to treat certain heart rhythm disorders, particularly atrial and ventricular arrhythmias. Its mode of action involves being a beta-adrenergic receptor antagonist and a class III antiarrhythmic agent. Sotalol works by blocking beta-adrenergic receptors in the heart, leading to a reduction in heart rate and contractility, and by prolonging the action potential duration in cardiac cells, thereby stabilizing heart rhythm. This helps in preventing and controlling abnormal heart rhythms and maintaining a regular heartbeat.
CAS Number | 3930-20-9 |
Synonyms | N-[4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenyl]methanesulfonamide;hydrochloride |
Molecular Formula | C12H20N2O3S |
Purity | ≥95% |
Target | Adrenergic Receptor |
Solubility | Soluble in DMSO |
Storage | Store at -20C |
IUPAC Name | N-[4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenyl]methanesulfonamide |
InChI | InChI=1S/C12H20N2O3S/c1-9(2)13-8-12(15)10-4-6-11(7-5-10)14-18(3,16)17/h4-7,9,12-15H,8H2,1-3H3 |
InChIKey | ZBMZVLHSJCTVON-UHFFFAOYSA-N |
SMILES | CC(C)NCC(C1=CC=C(C=C1)NS(=O)(=O)C)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |