For research use only. Not for therapeutic Use.
Soyasapogenol A (Cat.No:R072720) is a natural compound found in soybeans and other leguminous plants. It possesses potential health benefits, including anti-inflammatory and antioxidant properties. Soyasapogenol A is being studied for its role in promoting cardiovascular health, bone density, and hormone regulation, contributing to its potential as a functional food ingredient.
CAS Number | 508-01-0 |
Molecular Formula | C30H50O4 |
Purity | ≥95% |
Target | Apoptosis |
IUPAC Name | (3R,4S,4aR,6aR,6aS,6bR,8aR,9S,10S,12aR,14bS)-9-(hydroxymethyl)-2,2,4a,6a,6b,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-3,4,10-triol |
InChI | InChI=1S/C30H50O4/c1-25(2)16-19-18-8-9-21-27(4)12-11-22(32)28(5,17-31)20(27)10-13-30(21,7)29(18,6)15-14-26(19,3)24(34)23(25)33/h8,19-24,31-34H,9-17H2,1-7H3/t19-,20+,21+,22-,23-,24+,26+,27-,28+,29+,30+/m0/s1 |
InChIKey | CDDWAYFUFNQLRZ-KJVHGCRFSA-N |
SMILES | CC1(CC2C3=CCC4C5(CCC(C(C5CCC4(C3(CCC2(C(C1O)O)C)C)C)(C)CO)O)C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |