For research use only. Not for therapeutic Use.
SPAA-52(Cat No.:I042706)is a small molecule compound designed to selectively target and inhibit specific enzymes or proteins involved in cellular signaling pathways. It is primarily studied for its potential applications in cancer and inflammation research. By modulating key signaling molecules, SPAA-52 disrupts processes such as cell proliferation, survival, and immune response, which are often dysregulated in diseases like cancer and autoimmune disorders. Preclinical studies have shown promise for SPAA-52 as a therapeutic agent, and researchers are investigating its potential to enhance the effectiveness of targeted therapies and improve treatment outcomes in various disease contexts.
CAS Number | 2837000-75-4 |
Synonyms | (3,5-dibromo-4-methylphenyl)carbamoylsulfamic acid |
Molecular Formula | C8H8Br2N2O4S |
Purity | ≥95% |
IUPAC Name | (3,5-dibromo-4-methylphenyl)carbamoylsulfamic acid |
InChI | InChI=1S/C8H8Br2N2O4S/c1-4-6(9)2-5(3-7(4)10)11-8(13)12-17(14,15)16/h2-3H,1H3,(H2,11,12,13)(H,14,15,16) |
InChIKey | XBWKZLBEUSPLFY-UHFFFAOYSA-N |
SMILES | CC1=C(C=C(C=C1Br)NC(=O)NS(=O)(=O)O)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |