For research use only. Not for therapeutic Use.
Sparfloxacin（Cat No.:A000639）is a broad-spectrum fluoroquinolone antibiotic used to treat various bacterial infections, including respiratory tract infections, sinusitis, and skin infections. It works by inhibiting bacterial DNA gyrase and topoisomerase IV, enzymes crucial for DNA replication and transcription, leading to bacterial cell death. Sparfloxacin is particularly effective against gram-positive and gram-negative bacteria, including drug-resistant strains. It is usually administered orally. Common side effects include gastrointestinal disturbances, photosensitivity, and potential cardiac issues like QT interval prolongation. Despite its efficacy, Sparfloxacin usage is limited due to safety concerns and the availability of safer alternatives.
| Catalog Number | A000639 |
| CAS Number | 110871-86-8 |
| Synonyms | 110871-86-8; Zagam; AT-4140; CI-978; Esparfloxacino |
| Molecular Formula | C19H22F2N4O3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 5-amino-1-cyclopropyl-7-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-6,8-difluoro-4-oxoquinoline-3-carboxylic acid |
| InChI | InChI=1S/C19H22F2N4O3/c1-8-5-24(6-9(2)23-8)17-13(20)15(22)12-16(14(17)21)25(10-3-4-10)7-11(18(12)26)19(27)28/h7-10,23H,3-6,22H2,1-2H3,(H,27,28)/t8-,9+ |
| InChIKey | DZZWHBIBMUVIIW-DTORHVGOSA-N |
| SMILES | CC1CN(CC(N1)C)C2=C(C(=C3C(=C2F)N(C=C(C3=O)C(=O)O)C4CC4)N)F |
