For research use only. Not for therapeutic Use.
Spathulenol is a naturally occurring sesquiterpene alcohol found in various essential oils, such as those from eucalyptus and patchouli. Known for its woody, earthy aroma, it possesses potential therapeutic properties, including anti-inflammatory, antimicrobial, and antioxidant effects. Spathulenol is studied for its medicinal applications and is also used in the fragrance and flavor industries.
CAS Number | 6750-60-3 |
Molecular Formula | C15H24O |
Purity | ≥95% |
Target | Disease Research Fields |
IUPAC Name | (1aR,4aR,7S,7aR,7bR)-1,1,7-trimethyl-4-methylidene-1a,2,3,4a,5,6,7a,7b-octahydrocyclopropa[h]azulen-7-ol |
InChI | InChI=1S/C15H24O/c1-9-5-6-11-13(14(11,2)3)12-10(9)7-8-15(12,4)16/h10-13,16H,1,5-8H2,2-4H3/t10-,11+,12+,13+,15-/m0/s1 |
InChIKey | FRMCCTDTYSRUBE-BGPZULBFSA-N |
SMILES | CC1(C2C1C3C(CCC3(C)O)C(=C)CC2)C |