For research use only. Not for therapeutic Use.
SPD-473 citrate is a serotonin/dopamine/norepinephrine reuptake inhibitior.
SPD-473 inhibits the synaptic reuptake of dopamine, serotonin and noradrenaline, making it a triple reuptake inhibitor potentially for the treatment of Parkinson’s Disease.
| Catalog Number | I046354 |
| CAS Number | 161190-26-7 |
| Synonyms | 1-[1-(3,4-dichlorophenyl)cyclobutyl]-2-[3-(dimethylamino)propylsulfanyl]ethanone;2-hydroxypropane-1,2,3-tricarboxylic acid |
| Molecular Formula | C23H31Cl2NO8S |
| Purity | ≥95% |
| InChI | InChI=1S/C17H23Cl2NOS.C6H8O7/c1-20(2)9-4-10-22-12-16(21)17(7-3-8-17)13-5-6-14(18)15(19)11-13;7-3(8)1-6(13,5(11)12)2-4(9)10/h5-6,11H,3-4,7-10,12H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | NWEDOXGMRSZNHG-UHFFFAOYSA-N |
| SMILES | CN(C)CCCSCC(=O)C1(CCC1)C2=CC(=C(C=C2)Cl)Cl.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
