For research use only. Not for therapeutic Use.
SPDV (Cat No.:I017803) is a cleavable linker used for the development of antibody-drug conjugates (ADCs) for cancer and B cell proliferative disease research. The linker is designed to be stable in circulation but can be cleaved in the tumor environment to release the cytotoxic payload. SPDV has been shown to have improved efficacy and reduced toxicity compared to other ADC linkers.
| Catalog Number | I017803 |
| CAS Number | 317331-86-5 |
| Molecular Formula | C₁₄H₁₆N₂O₄S₂ |
| Purity | ≥95% |
| Target | ADC Linker |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 5-(pyridin-2-yldisulfanyl)pentanoate |
| InChI | InChI=1S/C14H16N2O4S2/c17-12-7-8-13(18)16(12)20-14(19)6-2-4-10-21-22-11-5-1-3-9-15-11/h1,3,5,9H,2,4,6-8,10H2 |
| InChIKey | ABQGFYSYSCHJNB-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCCSSC2=CC=CC=N2 |
| Reference | [1]. Allen J. Ebens, et al. Antibodies and immunoconjugates and uses therefor. WO2007140371A2. |
