For research use only. Not for therapeutic Use.
SPH3127（Cat No.:I043303）is a small molecule inhibitor that targets the activity of the enzyme sphingosine kinase 1 (SK1), which plays a critical role in the production of sphingosine-1-phosphate (S1P), a bioactive lipid involved in regulating cell signaling, migration, and survival. By inhibiting SK1, SPH3127 modulates sphingolipid metabolism and has potential therapeutic applications in cancer, autoimmune diseases, and inflammation, where dysregulated S1P signaling contributes to disease progression. SPH3127 is under investigation for its ability to reduce tumor growth and improve immune responses by altering the balance of sphingolipid signaling.
| CAS Number | 1399849-02-5 |
| Synonyms | methyl N-[3-[3-[(1R)-1-[cyclopropyl-[(2R)-morpholine-2-carbonyl]amino]ethyl]-6-methylpyrazolo[3,4-b]pyridin-1-yl]propyl]carbamate |
| Molecular Formula | C22H32N6O4 |
| Purity | ≥95% |
| IUPAC Name | methyl N-[3-[3-[(1R)-1-[cyclopropyl-[(2R)-morpholine-2-carbonyl]amino]ethyl]-6-methylpyrazolo[3,4-b]pyridin-1-yl]propyl]carbamate |
| InChI | InChI=1S/C22H32N6O4/c1-14-5-8-17-19(26-27(20(17)25-14)11-4-9-24-22(30)31-3)15(2)28(16-6-7-16)21(29)18-13-23-10-12-32-18/h5,8,15-16,18,23H,4,6-7,9-13H2,1-3H3,(H,24,30)/t15-,18-/m1/s1 |
| InChIKey | GRTDDIZIUSADLD-CRAIPNDOSA-N |
| SMILES | CC1=NC2=C(C=C1)C(=NN2CCCNC(=O)OC)[C@@H](C)N(C3CC3)C(=O)[C@H]4CNCCO4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
