For research use only. Not for therapeutic Use.
SKI-II(Cat No.:I003101)is a selective inhibitor of sphingosine kinase, an enzyme responsible for converting sphingosine to sphingosine-1-phosphate (S1P), a bioactive lipid involved in various cellular processes such as growth, survival, and immune modulation. By inhibiting sphingosine kinase, SKI-II reduces the levels of S1P, which can influence cell proliferation, apoptosis, and inflammation. It has been studied for its potential therapeutic applications in cancer, autoimmune diseases, and cardiovascular conditions. Preclinical research suggests that SKI-II could help limit tumor growth, modulate immune responses, and potentially reduce fibrosis, though further clinical studies are needed.
CAS Number | 312636-16-1 |
Synonyms | 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]phenol |
Molecular Formula | C₁₅H₁₁ClN₂OS |
Purity | ≥95% |
Target | Stem Cell/Wnt |
Solubility | DMSO: > 34 mg/mL |
Storage | Store at -20 ℃ |
IC50 | 78/45 μM (SK1/2) |
IUPAC Name | 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]phenol |
InChI | InChI=1S/C15H11ClN2OS/c16-11-3-1-10(2-4-11)14-9-20-15(18-14)17-12-5-7-13(19)8-6-12/h1-9,19H,(H,17,18) |
InChIKey | ZFGXZJKLOFCECI-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C2=CSC(=N2)NC3=CC=C(C=C3)O)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |