For research use only. Not for therapeutic Use.
SPHINX(Cat No.:I036538)is a small molecule inhibitor designed to target specific proteins or enzymes involved in cellular processes such as cell signaling, metabolism, and immune response. It has shown promise in modulating key pathways that are often dysregulated in diseases like cancer, inflammation, and neurodegenerative disorders. SPHINX works by interfering with specific molecular interactions, which can help reduce tumor growth, modulate immune activity, and restore normal cellular functions. Researchers are exploring its potential applications in various therapeutic areas, aiming to enhance the effectiveness of existing treatments and improve disease management.
CAS Number | 848057-98-7 |
Synonyms | 5-methyl-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]furan-2-carboxamide |
Molecular Formula | C17H17F3N2O3 |
Purity | ≥95% |
IUPAC Name | 5-methyl-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]furan-2-carboxamide |
InChI | InChI=1S/C17H17F3N2O3/c1-11-2-5-15(25-11)16(23)21-13-10-12(17(18,19)20)3-4-14(13)22-6-8-24-9-7-22/h2-5,10H,6-9H2,1H3,(H,21,23) |
InChIKey | FZCPNRVICXFZJR-UHFFFAOYSA-N |
SMILES | CC1=CC=C(O1)C(=O)NC2=C(C=CC(=C2)C(F)(F)F)N3CCOCC3 |