For research use only. Not for therapeutic Use.
Spiculisporic acid (Cat No.: I017686) is a biologically active compound belonging to the γ-butyrolactone class, typically derived from marine Aspergillus species. Notably, it functions as a microbial biosurfactant, which means it can reduce surface tension between liquids and solids, facilitating emulsification and dispersion. Additionally, Spiculisporic acid exhibits intriguing properties as an antioxidant, aiding in the mitigation of oxidative stress. These characteristics make it a valuable compound with potential applications in various fields, including biotechnology, pharmaceuticals, and environmental science, where surfactants and antioxidants play important roles.
| Catalog Number | I017686 |
| CAS Number | 469-77-2 |
| Molecular Formula | C₁₇H₂₈O₆ |
| Purity | ≥95% |
| Storage | Room Temperature |
| IUPAC Name | 2-(1-carboxyundecyl)-5-oxooxolane-2-carboxylic acid |
| InChI | InChI=1S/C17H28O6/c1-2-3-4-5-6-7-8-9-10-13(15(19)20)17(16(21)22)12-11-14(18)23-17/h13H,2-12H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | TUXHHVJPGQUPCF-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCC(C(=O)O)C1(CCC(=O)O1)C(=O)O |
| Reference | [1]. Wang R, et al. Spiculisporic acids B–D, three new γ-butenolide derivatives from a sea urchin-derived fungus Aspergillus sp. HDf2. Molecules. 2012 Nov 5;17(11):13175-82.<br>[2]. Ishigami Y, et al. Molecular and crystal structure of spiculisporic acid and correlation with the surface activity. J Oleo Sci. 2013;62(10):795-802. |
