Spironolactone-d7（Cat No.:S000850） is a deuterated form of spironolactone where seven hydrogen atoms are replaced with deuterium, enhancing its molecular stability with the formula C24H25D7O4S. This stable isotope-labeled diuretic and antihypertensive agent is used in mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy to improve the detection and quantification of metabolites in pharmacokinetic and metabolic studies. Spironolactone-d7 is crucial for researching the drug’s therapeutic effects and metabolism, particularly in treatments related to heart failure, hypertension, and conditions related to excess aldosterone, offering deeper insights into its pharmacological dynamics.
| Catalog Number | S000850 |
| Molecular Formula | C24H25D7O4S |
| Purity | ≥95% |
| IUPAC Name | S-[(7R,8R,9S,10R,13S,14S,17R)-2,2,4,4',4',6,7-heptadeuterio-10,13-dimethyl-3,5'-dioxospiro[6,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-7-yl] ethanethioate |
| InChI | InChI=1S/C24H32O4S/c1-14(25)29-19-13-15-12-16(26)4-8-22(15,2)17-5-9-23(3)18(21(17)19)6-10-24(23)11-7-20(27)28-24/h12,17-19,21H,4-11,13H2,1-3H3/t17-,18-,19+,21+,22-,23-,24+/m0/s1/i4D2,7D2,12D,13D,19D/t13?,17-,18-,19+,21+,22-,23-,24+ |
| InChIKey | LXMSZDCAJNLERA-BLXBWACRSA-N |
| SMILES | CC(=O)SC1CC2=CC(=O)CCC2(C3C1C4CCC5(C4(CC3)C)CCC(=O)O5)C |
