For research use only. Not for therapeutic Use.
SR-717 lithium (Cat.No:I036617) is a potent, selective inhibitor of GSK-3β, a critical enzyme in various signaling pathways. Known for its neuroprotective properties, SR-717 Lithium is primarily used in research on neurodegenerative diseases, including Alzheimer’s and Parkinson’s. By modulating the Wnt/β-catenin signaling pathway, it may have therapeutic potential in cognitive dysfunctions. Its role in enhancing neuroplasticity and reducing neuronal apoptosis is under investigation, making it a valuable tool in studying neurodegeneration and potential drug development.
| Catalog Number | I036617 |
| CAS Number | 2375421-09-1 |
| Synonyms | SR-717 lithium; SR 717 lithium; SR717 lithium; |
| Molecular Formula | C15H8F2LiN5O3 |
| Purity | 98% |
| Target | STING |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 ℃ for short term (days to weeks) or -20 ℃ for long term (months to years). |
| IUPAC Name | lithium 2-(6-(1H-imidazol-1-yl)pyridazine-3-carboxamido)-4,5-difluorobenzoate |
| InChI | InChI=1S/C15H9F2N5O3.Li/c16-9-5-8(15(24)25)12(6-10(9)17)19-14(23)11-1-2-13(21-20-11)22-4-3-18-7-22;/h1-7H,(H,19,23)(H,24,25);/q;+1/p-1 |
| InChIKey | ODSAJRWPLSVEHJ-UHFFFAOYSA-M |
| SMILES | O=C([O-])C1=CC(F)=C(F)C=C1NC(C2=NN=C(N3C=CN=C3)C=C2)=O.[Li+] |
