For research use only. Not for therapeutic Use.
SR9238（Cat No.:I011228） is a synthetic compound that acts as a reverse agonist of liver X receptor (LXR) and has been shown to have IC50 values of 214 nM and 43 nM for LXRα and LXRβ, respectively. By binding to LXRs, SR9238 inhibits the activity of these transcription factors, which are involved in the regulation of lipid and glucose metabolism.
| Catalog Number | I011228 |
| CAS Number | 1416153-62-2 |
| Synonyms | Ethyl 5-[[[[3/’-(Methylsulfonyl)[1,1/’-biphenyl]-4-yl]methyl][(2,4,6-trimethylphenyl)sulfonyl]amino]methyl]-2-furancarboxylate |
| Molecular Formula | C31H33NO7S2 |
| Purity | ≥95% |
| Target | LXR |
| Solubility | Soluble to 100 mM in DMSO |
| Storage | 2-8°C |
| IUPAC Name | ethyl 5-[[[4-(3-methylsulfonylphenyl)phenyl]methyl-(2,4,6-trimethylphenyl)sulfonylamino]methyl]furan-2-carboxylate |
| InChI | InChI=1S/C31H33NO7S2/c1-6-38-31(33)29-15-14-27(39-29)20-32(41(36,37)30-22(3)16-21(2)17-23(30)4)19-24-10-12-25(13-11-24)26-8-7-9-28(18-26)40(5,34)35/h7-18H,6,19-20H2,1-5H3 |
| InChIKey | HDZWHJYZJWLTAG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(O1)CN(CC2=CC=C(C=C2)C3=CC(=CC=C3)S(=O)(=O)C)S(=O)(=O)C4=C(C=C(C=C4C)C)C |
