For research use only. Not for therapeutic Use.
SR1001(Cat No.:I001279)is a selective modulator of nuclear receptors RORα and RORγ, key regulators of immune function and metabolism. By inhibiting these receptors, SR1001 effectively reduces the production of pro-inflammatory cytokines and Th17 cell differentiation, making it a promising compound for treating autoimmune diseases such as multiple sclerosis and rheumatoid arthritis. Additionally, SR1001 has been explored for its potential role in metabolic disorders due to its influence on circadian rhythms and lipid metabolism. Its ability to target specific immune pathways makes SR1001 a valuable tool in immunology and metabolic research.
Catalog Number | I001279 |
CAS Number | 1335106-03-0 |
Synonyms | (Z)-N-(5-(N-(4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl)sulfamoyl)-4-methylthiazol-2-yl)acetimidic acid |
Molecular Formula | C15H13F6N3O4S2 |
Purity | ≥95% |
Target | Vitamin D Related/Nuclear Receptor |
Solubility | DMSO: ≥ 39 mg/mL |
Storage | Store at +4C |
IUPAC Name | N-[5-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]sulfamoyl]-4-methyl-1,3-thiazol-2-yl]acetamide |
InChI | InChI=1S/C15H13F6N3O4S2/c1-7-11(29-12(22-7)23-8(2)25)30(27,28)24-10-5-3-9(4-6-10)13(26,14(16,17)18)15(19,20)21/h3-6,24,26H,1-2H3,(H,22,23,25) |
InChIKey | OZBSSKGBKHOLGA-UHFFFAOYSA-N |
SMILES | CC1=C(SC(=N1)NC(=O)C)S(=O)(=O)NC2=CC=C(C=C2)C(C(F)(F)F)(C(F)(F)F)O |
Reference | <p style=/line-height:25px/> |