For research use only. Not for therapeutic Use.
SR33805 is a calcium channel blocker known for its potent vasodilatory effects. It selectively inhibits L-type calcium channels, which are crucial in regulating the contraction of smooth muscle cells, particularly in the cardiovascular system. By blocking these channels, SR33805 helps to relax blood vessels, reduce blood pressure, and decrease the workload on the heart. It has been studied for its potential therapeutic applications in treating conditions such as hypertension, angina, and other cardiovascular disorders, where calcium channel modulation is beneficial.
| Catalog Number | I010641 |
| CAS Number | 121345-64-0 |
| Synonyms | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-[4-(1-methyl-2-propan-2-ylindol-3-yl)sulfonylphenoxy]propan-1-amine |
| Molecular Formula | C32H40N2O5S |
| Purity | ≥95% |
| InChI | InChI=1S/C32H40N2O5S/c1-23(2)31-32(27-10-7-8-11-28(27)34(31)4)40(35,36)26-15-13-25(14-16-26)39-21-9-19-33(3)20-18-24-12-17-29(37-5)30(22-24)38-6/h7-8,10-17,22-23H,9,18-21H2,1-6H3 |
| InChIKey | OGLMUIRZIMTHMN-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C2=CC=CC=C2N1C)S(=O)(=O)C3=CC=C(C=C3)OCCCN(C)CCC4=CC(=C(C=C4)OC)OC |
