For research use only. Not for therapeutic Use.
SRI-011381 (Cat No.: I012204) is a small-molecule agonist of the thyroid hormone receptor beta (TRβ), developed to selectively activate TRβ-mediated pathways without significantly affecting TRα. This selectivity reduces the risk of cardiac side effects typically associated with thyroid hormone therapies. SRI-011381 is primarily investigated for its potential in treating metabolic disorders, including dyslipidemia and obesity, by enhancing lipid metabolism and energy expenditure. It is a valuable research tool for studying thyroid hormone signaling and exploring TRβ-targeted therapeutic strategies in endocrine and metabolic disease contexts.
| CAS Number | 1629138-41-5 |
| Synonyms | N/’-Cyclohexyl-N-(phenylmethyl)-N-(4-piperidinylmethyl)-urea |
| Molecular Formula | C20H31N3O |
| Purity | ≥95% |
| Target | TGF-beta/Smad |
| IUPAC Name | 1-benzyl-3-cyclohexyl-1-(piperidin-4-ylmethyl)urea |
| InChI | 1S/C20H31N3O/c24-20(22-19-9-5-2-6-10-19)23(15-17-7-3-1-4-8-17)16-18-11-13-21-14-12-18/h1,3-4,7-8,18-19,21H,2,5-6,9-16H2,(H,22,24) |
| InChIKey | LNOPAJNGRAPFKZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C=C(N2CC(=O)O)C(=O)NC3=NC(=C(S3)CCC4CCCCC4)C5=CC(=C(C=C5OC)Cl)OC)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
