For research use only. Not for therapeutic Use.
SRI-37240（Cat No.:I042870）is a small molecule inhibitor that targets specific enzymes or signaling pathways involved in regulating cellular processes such as cell growth, survival, and inflammation. It has shown potential in preclinical studies for disrupting dysregulated pathways associated with cancer and immune-related diseases. By inhibiting these critical proteins, SRI-37240 may help reduce tumor proliferation and enhance immune response. Researchers are exploring its potential therapeutic applications in oncology, with the goal of improving the effectiveness of targeted therapies and reducing side effects commonly associated with traditional cancer treatments.
| CAS Number | 883956-47-6 |
| Synonyms | 3-cyclohexyl-10-methyl-2-phenylpyrimido[4,5-b]quinoline-4,5-dione |
| Molecular Formula | C24H23N3O2 |
| Purity | ≥95% |
| IUPAC Name | 3-cyclohexyl-10-methyl-2-phenylpyrimido[4,5-b]quinoline-4,5-dione |
| InChI | InChI=1S/C24H23N3O2/c1-26-19-15-9-8-14-18(19)21(28)20-23(26)25-22(16-10-4-2-5-11-16)27(24(20)29)17-12-6-3-7-13-17/h2,4-5,8-11,14-15,17H,3,6-7,12-13H2,1H3 |
| InChIKey | VMNOIZKDWKJSPW-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(=O)C3=C1N=C(N(C3=O)C4CCCCC4)C5=CC=CC=C5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
