For research use only. Not for therapeutic Use.
SRI-37330 hydrochloride(Cat No.:I036632)is a selective inhibitor of the enzyme phosphoinositide 3-kinase (PI3K), specifically targeting the PI3Kα isoform. PI3K plays a crucial role in regulating cell growth, survival, and metabolism, and its dysregulation is associated with various cancers and metabolic disorders. By inhibiting PI3Kα, SRI-37330 hydrochloride aims to block oncogenic signaling pathways, suppress tumor growth, and potentially overcome resistance to existing cancer therapies. This compound is being studied for its therapeutic potential in treating cancers, particularly those with mutations in the PI3K pathway, as well as metabolic diseases linked to PI3K dysregulation.
CAS Number | 2322245-49-6 |
Synonyms | N-[[1-[6-(trifluoromethyl)quinazolin-4-yl]piperidin-3-yl]methyl]methanesulfonamide;hydrochloride |
Molecular Formula | C16H20ClF3N4O2S |
Purity | ≥95% |
IUPAC Name | N-[[1-[6-(trifluoromethyl)quinazolin-4-yl]piperidin-3-yl]methyl]methanesulfonamide;hydrochloride |
InChI | InChI=1S/C16H19F3N4O2S.ClH/c1-26(24,25)22-8-11-3-2-6-23(9-11)15-13-7-12(16(17,18)19)4-5-14(13)20-10-21-15;/h4-5,7,10-11,22H,2-3,6,8-9H2,1H3;1H |
InChIKey | SIWGSSRKYJTJTF-UHFFFAOYSA-N |
SMILES | CS(=O)(=O)NCC1CCCN(C1)C2=NC=NC3=C2C=C(C=C3)C(F)(F)F.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |