For research use only. Not for therapeutic Use.
SRI-37330（Cat No.:I042653）is a small molecule inhibitor designed to target specific proteins or enzymes involved in cellular signaling, particularly those associated with cancer and immune responses. It works by inhibiting key molecular pathways that regulate cell growth, survival, and apoptosis, disrupting processes that are often dysregulated in tumor cells. SRI-37330 has demonstrated promising results in preclinical studies, showing potential in reducing tumor proliferation and enhancing immune system activity. Researchers are exploring its therapeutic applications in oncology and autoimmune diseases, aiming to improve the effectiveness of targeted cancer therapies and immune modulation.
| CAS Number | 2322245-42-9 |
| Synonyms | N-[[1-[6-(trifluoromethyl)quinazolin-4-yl]piperidin-3-yl]methyl]methanesulfonamide |
| Molecular Formula | C16H19F3N4O2S |
| Purity | ≥95% |
| IUPAC Name | N-[[1-[6-(trifluoromethyl)quinazolin-4-yl]piperidin-3-yl]methyl]methanesulfonamide |
| InChI | InChI=1S/C16H19F3N4O2S/c1-26(24,25)22-8-11-3-2-6-23(9-11)15-13-7-12(16(17,18)19)4-5-14(13)20-10-21-15/h4-5,7,10-11,22H,2-3,6,8-9H2,1H3 |
| InChIKey | WRSNFEVXRKOMLL-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NCC1CCCN(C1)C2=NC=NC3=C2C=C(C=C3)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
