For research use only. Not for therapeutic Use.
SRI-41315(Cat No.:I042869)is a selective small molecule inhibitor designed to target specific proteins or enzymes involved in cellular signaling pathways, particularly those associated with cancer and inflammation. By inhibiting key enzymes or receptors, SRI-41315 disrupts critical cellular processes like cell proliferation, survival, and immune responses. The compound has shown potential in preclinical studies for its ability to modulate tumor growth and reduce inflammation. Researchers are investigating its therapeutic applications in oncology and inflammatory diseases, aiming to improve the effectiveness of targeted therapies and enhance treatment outcomes in various disease contexts.
CAS Number | 1613509-49-1 |
Synonyms | 2-cyclobutyl-10-methyl-3-phenylpyrimido[4,5-b]quinoline-4,5-dione |
Molecular Formula | C22H19N3O2 |
Purity | ≥95% |
IUPAC Name | 2-cyclobutyl-10-methyl-3-phenylpyrimido[4,5-b]quinoline-4,5-dione |
InChI | InChI=1S/C22H19N3O2/c1-24-17-13-6-5-12-16(17)19(26)18-21(24)23-20(14-8-7-9-14)25(22(18)27)15-10-3-2-4-11-15/h2-6,10-14H,7-9H2,1H3 |
InChIKey | XUOTZAUZHWCGHL-UHFFFAOYSA-N |
SMILES | CN1C2=CC=CC=C2C(=O)C3=C1N=C(N(C3=O)C4=CC=CC=C4)C5CCC5 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |