For research use only. Not for therapeutic Use.
SRT3025 HCl (Cat.No:I036638) is a synthetic compound known for its potential as a small molecule activator of the NAD+-dependent deacetylase enzyme, SIRT1. It has been studied for its beneficial effects on metabolic health, cellular longevity, and potential anti-aging properties. Further research is underway to explore its therapeutic applications in various age-related diseases.
| Catalog Number | I036638 |
| CAS Number | 2070015-26-6 |
| Synonyms | SRT3025; SRT-3025; SRT 3025; SRT3025 HCl; SRT3025 hydrochloride |
| Molecular Formula | C31H32ClN5O2S2 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 5-(3-Methoxypropyl)-2-phenyl-N-[2-[6-(1-pyrrolidinylmethyl)thiazolo[5,4-b]pyridin-2-yl]phenyl]-4-thiazolecarboxamide hydrochloride |
| InChI | InChI=1S/C31H31N5O2S2.ClH/c1-38-17-9-14-26-27(35-29(39-26)22-10-3-2-4-11-22)28(37)33-24-13-6-5-12-23(24)30-34-25-18-21(19-32-31(25)40-30)20-36-15-7-8-16-36;/h2-6,10-13,18-19H,7-9,14-17,20H2,1H3,(H,33,37);1H |
| InChIKey | LGRBDTOIPNDWMN-UHFFFAOYSA-N |
| SMILES | O=C(C1=C(CCCOC)SC(C2=CC=CC=C2)=N1)NC3=CC=CC=C3C4=NC5=CC(CN6CCCC6)=CN=C5S4.[H]Cl |
