SRT3109（Cat No.:I000755）is a small molecule inhibitor primarily studied for its potential role in modulating cellular pathways related to inflammation and immune response. Though detailed information on its exact mechanism is still being explored, SRT3109 has garnered interest for its ability to interfere with key signaling cascades in preclinical models of autoimmune and inflammatory diseases. Researchers are investigating its therapeutic potential in conditions where abnormal immune activation is implicated, aiming to better understand its effectiveness in reducing inflammation and improving disease outcomes.
| Catalog Number | I000755 |
| CAS Number | 1204707-71-0 |
| Synonyms | SRT-3109;SRT 3109 |
| Molecular Formula | C18H23F2N5O4S2 |
| Purity | ≥95% |
| Target | CXCR |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | N-[2-[(2,3-difluorophenyl)methylsulfanyl]-6-[[(2R,3R)-3,4-dihydroxybutan-2-yl]amino]pyrimidin-4-yl]azetidine-1-sulfonamide |
| InChI | InChI=1S/C18H23F2N5O4S2/c1-11(14(27)9-26)21-15-8-16(24-31(28,29)25-6-3-7-25)23-18(22-15)30-10-12-4-2-5-13(19)17(12)20/h2,4-5,8,11,14,26-27H,3,6-7,9-10H2,1H3,(H2,21,22,23,24)/t11-,14+/m1/s1 |
| InChIKey | QVKPEMXUBULFBM-RISCZKNCSA-N |
| SMILES | C[C@H]([C@H](CO)O)NC1=CC(=NC(=N1)SCC2=C(C(=CC=C2)F)F)NS(=O)(=O)N3CCC3 |
