For research use only. Not for therapeutic Use.
(S,S)-GNE 5729(Cat No.:I042336)is a selective inhibitor of the enzyme UDP-glucose pyrophosphorylase (UGPase), which is involved in the synthesis of UDP-glucose, a key substrate in cellular metabolism and glycosylation processes. By inhibiting UGPase, (S,S)-GNE 5729 has the potential to disrupt glycosylation pathways, which are crucial in various biological processes, including cell signaling and protein folding. This compound has been studied for its potential use in cancer research, where altered glycosylation patterns contribute to tumor progression. It may also hold promise in treating diseases related to metabolic dysregulation.
CAS Number | 2026636-06-4 |
Synonyms | (1S,2S)-2-[7-chloro-2-[[5-chloro-3-(trifluoromethyl)pyrazol-1-yl]methyl]-4-oxopyrido[1,2-a]pyrimidin-6-yl]cyclopropane-1-carbonitrile |
Molecular Formula | C17H10Cl2F3N5O |
Purity | ≥95% |
IUPAC Name | (1S,2S)-2-[7-chloro-2-[[5-chloro-3-(trifluoromethyl)pyrazol-1-yl]methyl]-4-oxopyrido[1,2-a]pyrimidin-6-yl]cyclopropane-1-carbonitrile |
InChI | InChI=1S/C17H10Cl2F3N5O/c18-11-1-2-14-24-9(7-26-13(19)5-12(25-26)17(20,21)22)4-15(28)27(14)16(11)10-3-8(10)6-23/h1-2,4-5,8,10H,3,7H2/t8-,10+/m1/s1 |
InChIKey | GPMGDUIAVSFGGH-SCZZXKLOSA-N |
SMILES | C1[C@@H]([C@H]1C2=C(C=CC3=NC(=CC(=O)N32)CN4C(=CC(=N4)C(F)(F)F)Cl)Cl)C#N |