For research use only. Not for therapeutic Use.
(S,S)-Palonosetron-d3 Hydrochloride is a deuterated form of (S,S)-palonosetron, a highly selective 5-HT3 receptor antagonist used to prevent nausea and vomiting associated with chemotherapy and surgery. The three deuterium atoms replace hydrogen atoms in the molecule, providing a stable isotopic label that enhances its utility in pharmacokinetic and metabolic studies. This labeled compound allows for precise tracking of the drug’s absorption, distribution, metabolism, and excretion in biological systems. Its applications are crucial in pharmaceutical research for optimizing therapeutic strategies, studying drug interactions, and improving the safety and efficacy of antiemetic treatments.
CAS Number | 1246816-81-8 |
Synonyms | (3aS)-2-(3S)-1-Azabicyclo[2.2.2]oct-3-yl-2,3,3a,4,5,6-hexahydro-1H-benz[de]isoquinolin-1-one-d3 Hydrochloride; Aloxi-d3; Onicit-d3; RS-25259-197-d3; |
Molecular Formula | C19H25ClN2O |
Purity | ≥95% |
Target | Neuronal Signaling |
Storage | 3 years -20C powder |
IUPAC Name | (3aS)-3,3-dideuterio-2-[(3S)-3-deuterio-1-azabicyclo[2.2.2]octan-3-yl]-3a,4,5,6-tetrahydrobenzo[de]isoquinolin-1-one;hydrochloride |
InChI | InChI=1S/C19H24N2O.ClH/c22-19-16-6-2-4-14-3-1-5-15(18(14)16)11-21(19)17-12-20-9-7-13(17)8-10-20;/h2,4,6,13,15,17H,1,3,5,7-12H2;1H/t15-,17-;/m1./s1/i11D2,17D; |
InChIKey | OLDRWYVIKMSFFB-RAVRUBKISA-N |
SMILES | [2H][C@]1(CN2CCC1CC2)N3C(=O)C4=CC=CC5=C4[C@@H](C3([2H])[2H])CCC5.Cl |