For research use only. Not for therapeutic Use.
SS-RJW100(Cat No.:I042848)is a small molecule compound that serves as a selective inhibitor of specific enzymes or proteins involved in cellular signaling pathways, particularly those related to cancer and inflammation. By targeting these critical molecules, SS-RJW100 disrupts processes such as cell survival, proliferation, and immune response, which are often dysregulated in various diseases. It shows potential in preclinical studies as a therapeutic agent for cancer and autoimmune disorders. Researchers are investigating its ability to enhance the effectiveness of targeted therapies, aiming to improve patient outcomes and reduce side effects associated with conventional treatments.
Synonyms | (1S,3aS,6aS)-5-hexyl-4-phenyl-3a-(1-phenylethenyl)-2,3,6,6a-tetrahydro-1H-pentalen-1-ol |
Molecular Formula | C28H34O |
Purity | ≥95% |
IUPAC Name | (1S,3aS,6aS)-5-hexyl-4-phenyl-3a-(1-phenylethenyl)-2,3,6,6a-tetrahydro-1H-pentalen-1-ol |
InChI | InChI=1S/C28H34O/c1-3-4-5-8-17-24-20-25-26(29)18-19-28(25,21(2)22-13-9-6-10-14-22)27(24)23-15-11-7-12-16-23/h6-7,9-16,25-26,29H,2-5,8,17-20H2,1H3/t25-,26+,28-/m1/s1 |
InChIKey | ZFXMYHPLTQTTFW-FULLSBAXSA-N |
SMILES | CCCCCCC1=C([C@]2(CC[C@@H]([C@H]2C1)O)C(=C)C3=CC=CC=C3)C4=CC=CC=C4 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |