For research use only. Not for therapeutic Use.
SSAA09E3（Cat No.:I012202）is a small molecule compound that acts as a potent and selective inhibitor of the protein phosphatase 2A (PP2A). PP2A is a key enzyme involved in regulating various cellular processes, including cell growth, differentiation, and apoptosis. By inhibiting PP2A, SSAA09E3 modulates cellular signaling pathways and has shown potential in cancer research, where PP2A activity is often dysregulated. This compound is being studied for its ability to enhance anti-tumor immunity, disrupt cancer cell proliferation, and improve the effectiveness of existing cancer therapies, making it a promising candidate for targeted cancer treatments.
| CAS Number | 52869-18-8 |
| Synonyms | N-(9,10-dioxoanthracen-2-yl)benzamide |
| Molecular Formula | C21H13NO3 |
| Purity | ≥95% |
| IUPAC Name | N-(9,10-dioxoanthracen-2-yl)benzamide |
| InChI | InChI=1S/C21H13NO3/c23-19-15-8-4-5-9-16(15)20(24)18-12-14(10-11-17(18)19)22-21(25)13-6-2-1-3-7-13/h1-12H,(H,22,25) |
| InChIKey | SIGATAYQAZTAOH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC3=C(C=C2)C(=O)C4=CC=CC=C4C3=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
