For research use only. Not for therapeutic Use.
SSE15206（Cat No.:I019767）is a selective inhibitor of the enzyme phosphodiesterase 4 (PDE4), which plays a key role in regulating intracellular levels of cyclic adenosine monophosphate (cAMP). By inhibiting PDE4, SSE15206 enhances cAMP signaling, leading to reduced inflammation and improved immune responses. This compound is being investigated for its therapeutic potential in various inflammatory diseases, including asthma and chronic obstructive pulmonary disease (COPD). Preclinical studies suggest that SSE15206 may offer a more targeted approach with fewer side effects compared to broader anti-inflammatory agents, making it a promising candidate for further clinical development.
| Catalog Number | I019767 |
| CAS Number | 1370046-40-4 |
| Molecular Formula | C₁₉H₂₁N₃O₃S |
| Purity | ≥95% |
| Target | Cytoskeleton |
| Storage | 2-8°C |
| IUPAC Name | 5-phenyl-3-(3,4,5-trimethoxyphenyl)-3,4-dihydropyrazole-2-carbothioamide |
| InChI | InChI=1S/C19H21N3O3S/c1-23-16-9-13(10-17(24-2)18(16)25-3)15-11-14(21-22(15)19(20)26)12-7-5-4-6-8-12/h4-10,15H,11H2,1-3H3,(H2,20,26) |
| InChIKey | GONIBFCARADPAC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C2CC(=NN2C(=S)N)C3=CC=CC=C3 |
| Reference | [1]. Manzoor S, et al. Identification and characterization of SSE15206, a microtubule depolymerizing agent that overcomes multidrug resistance. Sci Rep. 2018 Feb 19;8(1):3305. |
