For research use only. Not for therapeutic Use.
SSR504734(Cat No.:I042973)is a selective small molecule inhibitor targeting specific enzymes involved in cellular signaling, particularly those related to the mitogen-activated protein kinase (MAPK) pathway. By inhibiting these enzymes, SSR504734 disrupts key processes such as cell proliferation, survival, and migration, which are often dysregulated in cancer. The compound is being explored for its potential therapeutic applications in oncology, particularly for tumors with aberrant MAPK pathway activation. Researchers are investigating its ability to enhance the effectiveness of cancer treatments, aiming to offer a targeted approach for improving patient outcomes in various malignancies.
CAS Number | 615571-23-8 |
Synonyms | 2-chloro-N-[(S)-phenyl-[(2S)-piperidin-2-yl]methyl]-3-(trifluoromethyl)benzamide;hydrochloride |
Molecular Formula | C20H21Cl2F3N2O |
Purity | ≥95% |
IUPAC Name | 2-chloro-N-[(S)-phenyl-[(2S)-piperidin-2-yl]methyl]-3-(trifluoromethyl)benzamide;hydrochloride |
InChI | InChI=1S/C20H20ClF3N2O.ClH/c21-17-14(9-6-10-15(17)20(22,23)24)19(27)26-18(13-7-2-1-3-8-13)16-11-4-5-12-25-16;/h1-3,6-10,16,18,25H,4-5,11-12H2,(H,26,27);1H/t16-,18-;/m0./s1 |
InChIKey | YGCZZYKACZXKHK-AKXYIILFSA-N |
SMILES | C1CCN[C@@H](C1)[C@H](C2=CC=CC=C2)NC(=O)C3=C(C(=CC=C3)C(F)(F)F)Cl.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |