For research use only. Not for therapeutic Use.
Starch(Cat No.:M025147), is a complex carbohydrate consisting of glucose units linked together through glycosidic bonds. It is one of the most abundant and essential carbohydrates in the plant kingdom and serves as a primary energy storage molecule for plants. Starch is a major component of many staple foods like potatoes, rice, and wheat, making it a crucial part of human nutrition. In industry, starch finds extensive use in various applications, including as a thickening agent, binding agent, and filler in food products, pharmaceuticals, and paper manufacturing. Its versatility and biodegradability contribute to its widespread usage in numerous sectors.
CAS Number | 9005-25-8 |
Synonyms | alpha-starch;amaizow13;amylomaizevii;aquapel(polysaccharide);argobrandcornstarch;claro5591;clearjel;cpc3005 |
Molecular Formula | C12H22O11 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol |
InChI | InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11+,12-/m1/s1 |
InChIKey | GUBGYTABKSRVRQ-ASMJPISFSA-N |
SMILES | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |