For research use only. Not for therapeutic Use.
STAT3-SH2 domain inhibitor 1（Cat No.:I042742）is a small molecule compound designed to specifically target and inhibit the Src Homology 2 (SH2) domain of STAT3, a transcription factor involved in various cellular processes such as cell growth, survival, and immune responses. The SH2 domain is crucial for STAT3 activation, and by blocking this domain, the inhibitor disrupts STAT3-mediated signaling pathways, which are often dysregulated in cancer and autoimmune diseases. STAT3-SH2 domain inhibitor 1 shows promise as a therapeutic agent for targeting tumors and inflammatory conditions, potentially improving treatment outcomes.
| CAS Number | 2816059-41-1 |
| Synonyms | [4-[(4-cyclohexylphenyl)methyl-[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]phenyl]boronic acid |
| Molecular Formula | C28H28BF5N2O5S |
| Purity | ≥95% |
| IUPAC Name | [4-[(4-cyclohexylphenyl)methyl-[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]phenyl]boronic acid |
| InChI | InChI=1S/C28H28BF5N2O5S/c1-35(42(40,41)28-26(33)24(31)23(30)25(32)27(28)34)16-22(37)36(21-13-11-20(12-14-21)29(38)39)15-17-7-9-19(10-8-17)18-5-3-2-4-6-18/h7-14,18,38-39H,2-6,15-16H2,1H3 |
| InChIKey | CEZFPVMURCGETD-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N(CC2=CC=C(C=C2)C3CCCCC3)C(=O)CN(C)S(=O)(=O)C4=C(C(=C(C(=C4F)F)F)F)F)(O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
