For research use only. Not for therapeutic Use.
Stat5 Inhibitor(CAT: I011805) functions by targeting the STAT5 transcription factor, impeding its role in cellular signaling pathways and gene expression. This inhibition has pharmacological implications, potentially influencing cancer cell growth, immune responses, and other cellular processes. Given its ability to modulate key pathways, the STAT5 inhibitor holds promise for therapeutic applications, particularly in cancer treatment and immunomodulation, where its selective action on STAT5 may provide avenues for managing disease progression and promoting desired cellular responses.
CAS Number | 285986-31-4 |
Synonyms | 2-[(4-oxo-4H-1-benzopyran-3-yl)methylene]hydrazide 3-pyridinecarboxylic acid |
Molecular Formula | C₁₆H₁₁N₃O₃ |
Purity | ≥95% |
Target | Stem Cell/Wnt |
Solubility | Soluble in DMSO |
Storage | Store at -20°C |
InChI | InChI=1S/C16H11N3O3/c20-15-12(10-22-14-6-2-1-5-13(14)15)9-18-19-16(21)11-4-3-7-17-8-11/h1-10H,(H,19,21) |
InChIKey | DAVIKTBRCQWOGT-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=O)C(=CO2)C=NNC(=O)C3=CN=CC=C3 |