For research use only. Not for therapeutic Use.
STAT6-IN-2(CAT: I040903) is a selective inhibitor of STAT6 (Signal Transducer and Activator of Transcription 6), a key regulator in immune cell differentiation, particularly Th2 cells, and the production of cytokines such as IL-4 and IL-13. STAT6 is involved in the pathogenesis of allergic diseases, asthma, and certain cancers, where it contributes to chronic inflammation and immune dysregulation. By inhibiting STAT6, STAT6-IN-2 can reduce Th2-driven immune responses, offering therapeutic potential in managing inflammatory and autoimmune diseases. This compound is particularly relevant for Inflammation & Immunology Research, focusing on the development of targeted treatments for allergic conditions and Th2-associated disorders.
| Catalog Number | I040903 |
| CAS Number | 1355594-85-2 |
| Synonyms | 6-N-[(2R)-3-methylbutan-2-yl]-4-(1-methylindol-2-yl)-2-N-(2-pyridin-2-ylethyl)pyridine-2,6-dicarboxamide |
| Molecular Formula | C28H31N5O2 |
| Purity | ≥95% |
| IUPAC Name | 6-N-[(2R)-3-methylbutan-2-yl]-4-(1-methylindol-2-yl)-2-N-(2-pyridin-2-ylethyl)pyridine-2,6-dicarboxamide |
| InChI | InChI=1S/C28H31N5O2/c1-18(2)19(3)31-28(35)24-16-21(26-17-20-9-5-6-11-25(20)33(26)4)15-23(32-24)27(34)30-14-12-22-10-7-8-13-29-22/h5-11,13,15-19H,12,14H2,1-4H3,(H,30,34)(H,31,35)/t19-/m1/s1 |
| InChIKey | NQCIABFWMPKOJV-LJQANCHMSA-N |
| SMILES | CC(C)C(C)NC(=O)C1=CC(=CC(=N1)C(=O)NCCC2=CC=CC=N2)C3=CC4=CC=CC=C4N3C |
