For research use only. Not for therapeutic Use.
Stattic is a selective small-molecule inhibitor of STAT3 (Signal Transducer and Activator of Transcription 3), a transcription factor involved in cell proliferation, survival, and immune regulation. By preventing STAT3 activation and dimerization, Stattic disrupts its ability to regulate gene expression in cancer and inflammatory diseases. Stattic is widely used in research to study STAT3-driven oncogenic pathways, apoptosis induction, and immune modulation. Its potential to inhibit tumor growth and overcome drug resistance makes it valuable for cancer therapy studies.
| Catalog Number | I002533 |
| CAS Number | 19983-44-9 |
| Synonyms | 6-nitro-1-benzothiophene 1,1-dioxide |
| Molecular Formula | C₈H₅NO₄S |
| Purity | ≥95% |
| Target | Stem Cell/Wnt |
| Solubility | 10 mM in DMSO |
| Storage | -20 ℃ |
| IUPAC Name | 6-nitro-1-benzothiophene 1,1-dioxide |
| InChI | InChI=1S/C8H5NO4S/c10-9(11)7-2-1-6-3-4-14(12,13)8(6)5-7/h1-5H |
| InChIKey | ZRRGOUHITGRLBA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CS2(=O)=O)[N+](=O)[O-] |
