For research use only. Not for therapeutic Use.
Stattic(Cat No.:I002533)is a small-molecule inhibitor of Signal Transducer and Activator of Transcription 3 (STAT3), a transcription factor involved in regulating immune responses, cell survival, and tumor progression. STAT3 is often constitutively activated in various cancers, contributing to uncontrolled cell proliferation, metastasis, and resistance to apoptosis. By inhibiting STAT3, Stattic disrupts these cancer-promoting processes, showing potential as an anticancer agent. Preclinical studies have demonstrated that Stattic can reduce tumor growth and enhance the effects of other cancer therapies, making it a promising candidate for targeted cancer treatment and immunotherapy.
CAS Number | 19983-44-9 |
Synonyms | 6-nitro-1-benzothiophene 1,1-dioxide |
Molecular Formula | C₈H₅NO₄S |
Purity | ≥95% |
Target | Stem Cell/Wnt |
Solubility | 10 mM in DMSO |
Storage | -20 ℃ |
IUPAC Name | 6-nitro-1-benzothiophene 1,1-dioxide |
InChI | InChI=1S/C8H5NO4S/c10-9(11)7-2-1-6-3-4-14(12,13)8(6)5-7/h1-5H |
InChIKey | ZRRGOUHITGRLBA-UHFFFAOYSA-N |
SMILES | C1=CC(=CC2=C1C=CS2(=O)=O)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |