For research use only. Not for therapeutic Use.
Stauprimide（Cat No.:I001952）is a synthetic compound that belongs to a class of small molecules with potential anticancer and anti-inflammatory properties. It acts as a kinase inhibitor, interfering with specific enzymes involved in cellular processes such as cell division, growth, and apoptosis. By targeting these enzymes, Stauprimide may inhibit the proliferation of cancer cells and reduce inflammation. Although its precise mechanisms are still under investigation, it has shown promise in preclinical studies. Research is ongoing to determine its efficacy and safety in treating various cancers and inflammatory conditions.
| Catalog Number | I001952 |
| CAS Number | 154589-96-5 |
| Synonyms | N-((5S,6S,7R,9S)-6-methoxy-5-methyl-14,16-dioxo-5,6,7,8,9,14,15,16-octahydro-17-oxa-4b,9a,15-triaza-5,9-methanodibenzo[b,h]cyclonona[jkl]cyclopenta[e]-as-indacen-7-yl)-N-methylbenzamide |
| Molecular Formula | C35H28N4O5 |
| Purity | ≥95% |
| Target | Autophagy |
| Solubility | DMSO 100 mg/ml; Water <1 mg/ml |
| Storage | Store at -20C |
| IUPAC Name | N-[(2S,3R,4R,6R)-3-methoxy-2-methyl-16,18-dioxo-29-oxa-1,7,17-triazaoctacyclo[12.12.2.12,6.07,28.08,13.015,19.020,27.021,26]nonacosa-8,10,12,14,19,21,23,25,27-nonaen-4-yl]-N-methylbenzamide |
| InChI | InChI=1S/C35H28N4O5/c1-35-31(43-3)23(37(2)34(42)18-11-5-4-6-12-18)17-24(44-35)38-21-15-9-7-13-19(21)25-27-28(33(41)36-32(27)40)26-20-14-8-10-16-22(20)39(35)30(26)29(25)38/h4-16,23-24,31H,17H2,1-3H3,(H,36,40,41)/t23-,24-,31-,35+/m1/s1 |
| InChIKey | MQCCJEYZKWZQHU-MPRCCEKMSA-N |
| SMILES | C[C@@]12[C@@H]([C@@H](C[C@@H](O1)N3C4=CC=CC=C4C5=C6C(=C7C8=CC=CC=C8N2C7=C53)C(=O)NC6=O)N(C)C(=O)C9=CC=CC=C9)OC |
| Reference | <p style=/line-height:25px/> </p> |
