For research use only. Not for therapeutic Use.
Stepronin(Cat No.:I009598)is a small molecule compound with potential therapeutic applications, particularly in cardiovascular health. It acts as a selective inhibitor of platelet aggregation, preventing the clumping of platelets that can lead to blood clots. Stepronin is studied for its ability to improve blood flow and reduce the risk of thrombosis, which is a key factor in heart attacks, strokes, and other cardiovascular diseases. Researchers are exploring its potential as an antithrombotic agent to enhance cardiovascular treatments, especially in patients with a high risk of clot-related complications.
CAS Number | 72324-18-6 |
Synonyms | 2-[2-(thiophene-2-carbonylsulfanyl)propanoylamino]acetic acid |
Molecular Formula | C10H11NO4S2 |
Purity | ≥95% |
IUPAC Name | 2-[2-(thiophene-2-carbonylsulfanyl)propanoylamino]acetic acid |
InChI | InChI=1S/C10H11NO4S2/c1-6(9(14)11-5-8(12)13)17-10(15)7-3-2-4-16-7/h2-4,6H,5H2,1H3,(H,11,14)(H,12,13) |
InChIKey | JNYSEDHQJCOWQU-UHFFFAOYSA-N |
SMILES | CC(C(=O)NCC(=O)O)SC(=O)C1=CC=CS1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |