For research use only. Not for therapeutic Use.
STF-31 (Cat.No:I004698) is a chemical compound known for its role as a selective inhibitor of glucose transporter 1 (GLUT1). It interferes with glucose uptake in cancer cells, specifically those with elevated levels of GLUT1. STF-31 has shown promise in preclinical studies as a potential therapeutic approach for targeting GLUT1-dependent tumors.
| Catalog Number | I004698 |
| CAS Number | 724741-75-7 |
| Synonyms | 4-((4-(tert-butyl)phenylsulfonamido)methyl)-N-(pyridin-3-yl)benzamide |
| Molecular Formula | C₂₃H₂₅N₃O₃S |
| Purity | ≥95% |
| Target | Autophagy |
| Solubility | DMSO: ≥ 34 mg/mL |
| Storage | Store at RT |
| IC50 | 1 μM |
| IUPAC Name | 4-[[(4-tert-butylphenyl)sulfonylamino]methyl]-N-pyridin-3-ylbenzamide |
| InChI | InChI=1S/C23H25N3O3S/c1-23(2,3)19-10-12-21(13-11-19)30(28,29)25-15-17-6-8-18(9-7-17)22(27)26-20-5-4-14-24-16-20/h4-14,16,25H,15H2,1-3H3,(H,26,27) |
| InChIKey | NGQPRVWTFNBUHA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)S(=O)(=O)NCC2=CC=C(C=C2)C(=O)NC3=CN=CC=C3 |
