For research use only. Not for therapeutic Use.
Stigmasterol Ferulate (Cat No.:C001065) is a chemical compound formed by the esterification of ferulic acid with stigmasterol alcohol, which is a sterol derivative. It is a natural product found in various plant sources and has potential applications in the food and cosmetic industries. Stigmasterol Ferulate exhibits antioxidant and anti-inflammatory properties, making it valuable as a food additive and skincare ingredient. It is also studied for its potential health benefits, including its role in reducing oxidative stress and inflammation.
| Catalog Number | C001065 |
| CAS Number | 20972-08-1 |
| Synonyms | Stigmasterol Ferulate; 4-hydroxy-3-methoxy-stigmasta-5,22-dien-3β-yl Ester Cinnamic Acid; 4-Hydroxy-3-methoxycinnamate Stigmasterol; (3β,22E)-3-(4-Hydroxy-3-methoxyphenyl)-2-propenoate Stigmasta-5,22-dien-3-ol |
| Molecular Formula | C₃₉H₅₆O₄ |
| Purity | ≥95% |
| Solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| Appearance | White to Off-White Solid |
| Storage | -20°C |
| IUPAC Name | [(3S,8S,9S,10R,13R,14S,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| InChI | InChI=1S/C39H56O4/c1-8-28(25(2)3)12-9-26(4)32-15-16-33-31-14-13-29-24-30(19-21-38(29,5)34(31)20-22-39(32,33)6)43-37(41)18-11-27-10-17-35(40)36(23-27)42-7/h9-13,17-18,23,25-26,28,30-34,40H,8,14-16,19-22,24H2,1-7H3/b12-9+,18-11+/t26-,28-,30+,31+,32-,33+,34+,38+,39-/m1/s1 |
| InChIKey | NMWHNQAIHFWROQ-ZJNYQSGUSA-N |
| SMILES | CCC(C=CC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)OC(=O)C=CC5=CC(=C(C=C5)O)OC)C)C)C(C)C |
| Reference | Xu, Z., et al.: J. Agric. Food Chem., 47, 2724 (1999); |
