For research use only. Not for therapeutic Use.
STING agonist-1(Cat No.:I004635)is a small molecule that activates the Stimulator of Interferon Genes (STING) pathway, which plays a crucial role in the innate immune system’s response to pathogens and cancer. By activating STING, STING agonist-1 stimulates the production of type I interferons and other cytokines, enhancing the immune system’s ability to detect and respond to tumors and viral infections. Preclinical studies suggest it may have potential as an immunotherapy for cancer, by boosting anti-tumor immunity. Ongoing research is focused on its safety, efficacy, and potential applications in cancer treatment and infectious diseases.
CAS Number | 702662-50-8 |
Synonyms | 4-[(2-chloro-6-fluorophenyl)methyl]-N-(2-furanylmethyl)-3,4-dihydro-3-oxo-2H-1,4-benzothiazine-6-carboxamide |
Molecular Formula | C21H16ClFN2O3S |
Purity | ≥95% |
Target | Anti-infection |
Solubility | 10 mM in DMSO |
Storage | -20°C |
IC50 | 24.57 μM (IC90) |
IUPAC Name | 4-[(2-chloro-6-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-3-oxo-1,4-benzothiazine-6-carboxamide |
InChI | InChI=1S/C21H16ClFN2O3S/c22-16-4-1-5-17(23)15(16)11-25-18-9-13(6-7-19(18)29-12-20(25)26)21(27)24-10-14-3-2-8-28-14/h1-9H,10-12H2,(H,24,27) |
InChIKey | NAGKYJATVFXZKN-UHFFFAOYSA-N |
SMILES | C1C(=O)N(C2=C(S1)C=CC(=C2)C(=O)NCC3=CC=CO3)CC4=C(C=CC=C4Cl)F |