For research use only. Not for therapeutic Use.
STING agonist-1 (G10) is a ynthetic compound that activates the stimulator of interferon genes (STING) pathway, which plays a crucial role in the innate immune response. By stimulating STING, it induces the production of type I interferons and other pro-inflammatory cytokines, enhancing immune surveillance and anti-tumor activity. STING Agonist-1 is being investigated in cancer immunotherapy and infectious diseases for its potential to activate the immune system and improve therapeutic outcomes through enhanced immune activation.
Catalog Number | I004635 |
CAS Number | 702662-50-8 |
Synonyms | 4-[(2-chloro-6-fluorophenyl)methyl]-N-(2-furanylmethyl)-3,4-dihydro-3-oxo-2H-1,4-benzothiazine-6-carboxamide |
Molecular Formula | C21H16ClFN2O3S |
Purity | ≥95% |
Target | Anti-infection |
Solubility | 10 mM in DMSO |
Storage | -20°C |
IC50 | 24.57 μM (IC90) |
IUPAC Name | 4-[(2-chloro-6-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-3-oxo-1,4-benzothiazine-6-carboxamide |
InChI | 4-[(2-chloro-6-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-3-oxo-1,4-benzothiazine-6-carboxamide |
InChIKey | NAGKYJATVFXZKN-UHFFFAOYSA-N |
SMILES | C1C(=O)N(C2=C(S1)C=CC(=C2)C(=O)NCC3=CC=CO3)CC4=C(C=CC=C4Cl)F |