For research use only. Not for therapeutic Use.
STING Agonist-4 (Cat No.:I018730) is a potent small molecule that activates the stimulator of interferon genes (STING) pathway, a key component of the innate immune response. By stimulating STING, it enhances the production of type I interferons and pro-inflammatory cytokines, which are critical for immune system activation. STING Agonist-4 is being explored for its potential in cancer immunotherapy and antiviral treatments, as it can boost anti-tumor immunity and immune response to viral infections. Ideal for research in immune modulation.
CAS Number | 2138300-40-8 |
Molecular Formula | C₃₄H₃₈N₁₂O₄ |
Purity | ≥95% |
Target | STING |
IUPAC Name | 1-[4-[5-carbamoyl-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]benzimidazol-1-yl]butyl]-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]benzimidazole-5-carboxamide |
InChI | 1S/C34H38N12O4/c1-5-45-27(15-19(3)41-45)31(49)39-33-37-23-17-21(29(35)47)9-11-25(23)43(33)13-7-8-14-44-26-12-10-22(30(36)48)18-24(26)38-34(44)40-32(50)28-16-20(4)42-46(28)6-2/h9-12,15-18H,5-8,13-14H2,1-4H3,(H2,35,47)(H2,36,48)(H,37,39,49)(H,38,40,50) |
InChIKey | ICZSAXDKFXTSGL-UHFFFAOYSA-N |
SMILES | CCN1C(=CC(=N1)C)C(=O)NC2=NC3=C(N2CCCCN4C5=C(C=C(C=C5)C(=O)N)N=C4NC(=O)C6=CC(=NN6CC)C)C=CC(=C3)C(=O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |