For research use only. Not for therapeutic Use.
Strombine is a naturally occurring amino acid derivative, primarily found in invertebrates and some fish species. It is involved in anaerobic metabolism, particularly during periods of low oxygen availability, where it serves as an alternative energy source. Strombine is formed through the condensation of alanine and glyoxylate, playing a role in the unique metabolic adaptations of marine organisms. Its study provides insights into the biochemical processes that allow certain species to thrive in hypoxic environments, contributing to our understanding of evolutionary biology and metabolic regulation.
CAS Number | 56857-47-7 |
Molecular Formula | C5H9NO4 |
Purity | ≥95% |
IUPAC Name | (2S)-2-(carboxymethylamino)propanoic acid |
InChI | InChI=1S/C5H9NO4/c1-3(5(9)10)6-2-4(7)8/h3,6H,2H2,1H3,(H,7,8)(H,9,10)/t3-/m0/s1 |
InChIKey | XYUPSBLFPTWJLC-VKHMYHEASA-N |
SMILES | CC(C(=O)O)NCC(=O)O |