For research use only. Not for therapeutic Use.
Strontium Boride (Cat.No:M051413) is a binary compound of strontium and boron. It possesses exceptional hardness and is known for its high melting point, making it useful in specialized applications like cutting tools and abrasives. Strontium boride is also studied for its potential in superconductivity research.
| Catalog Number | M051413 |
| CAS Number | 12046-54-7 |
| Molecular Formula | B6Sr |
| Purity | ≥95% |
| Storage | Store at -20°C |
| InChI | InChI=1S/B6.Sr/c1-3-4(1)6-2-5(3)6;/q-2;+2 |
| InChIKey | YRKLZPTWAXIIDN-UHFFFAOYSA-N |
| SMILES | [B-]1B2B1B3B2[B-]3.[Sr+2] |
