For research use only. Not for therapeutic Use.
Suberic acid-d4（Cat No.:M083820）, also known as 1,8-octanedioic acid-d4, is a deuterated version of suberic acid, a dicarboxylic acid. In the deuterated form, the hydrogen atoms in the molecule are replaced by deuterium (a stable isotope of hydrogen). Suberic acid-d4 is commonly used in scientific research, particularly in studies involving isotopic labeling and nuclear magnetic resonance (NMR) spectroscopy. It aids in the tracking of molecular behavior and reactions, helping researchers analyze the structure and dynamics of complex compounds with enhanced precision.
| CAS Number | 19031-57-3 |
| Synonyms | 2,2,7,7-tetradeuteriooctanedioic acid |
| Molecular Formula | C8H10D4O4 |
| Purity | ≥95% |
| IUPAC Name | 2,2,7,7-tetradeuteriooctanedioic acid |
| InChI | InChI=1S/C8H14O4/c9-7(10)5-3-1-2-4-6-8(11)12/h1-6H2,(H,9,10)(H,11,12)/i5D2,6D2 |
| InChIKey | TYFQFVWCELRYAO-NZLXMSDQSA-N |
| SMILES | [2H]C([2H])(CCCCC([2H])([2H])C(=O)O)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
