For research use only. Not for therapeutic Use.
N-<wbr></wbr>Hydroxysuccinimide (NHS) activates carboxylic acid groups (on biotin) to facilitate coupling reactions. Biotin-<wbr></wbr>X-<wbr></wbr>NHS is a compound used to attach biotin to primary amines under alkaline conditions (pH~8-<wbr></wbr>9). For example, lysines on the surface of proteins, including antibodies, are ideal targets for biotinylation with this compound. Biotin-<wbr></wbr>X-<wbr></wbr>NHS is like Biotin-<wbr></wbr>NHS (Item No. <span class=/itemid/>13315</span>), but contains a six-<wbr></wbr>atom spacer arm to minimize steric effects.
CAS Number | 72040-63-2 |
Synonyms | NHS-LC-BIOTIN |
Molecular Formula | C20H30N4O6S |
Purity | ≥95% |
Target | PROTAC Linkers |
Storage | -20°C |
IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]hexanoate |
InChI | InChI=1S/C20H30N4O6S/c25-15(7-4-3-6-14-19-13(12-31-14)22-20(29)23-19)21-11-5-1-2-8-18(28)30-24-16(26)9-10-17(24)27/h13-14,19H,1-12H2,(H,21,25)(H2,22,23,29)/t13-,14-,19-/m0/s1 |
InChIKey | UVGHPGOONBRLCX-NJSLBKSFSA-N |
SMILES | C1CC(=O)N(C1=O)OC(=O)CCCCCNC(=O)CCCCC2C3C(CS2)NC(=O)N3 |