For research use only. Not for therapeutic Use.
Sucrose acetate isobutyrate(Cat No.:M071092), is a chemical compound used primarily in the food and beverage industry as an emulsifier, stabilizer, and thickening agent. It is particularly effective in preventing the separation of ingredients in citrus-flavored and alcoholic beverages, ensuring a consistent and appealing appearance. Moreover, sucrose acetate isobutyrate can enhance the solubility of certain flavor compounds in beverages and improve their overall taste.
Catalog Number | M071092 |
CAS Number | 126-13-6 |
Molecular Formula | C40H62O19 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [(2S,3S,4R,5R)-5-(acetyloxymethyl)-2-[(2R,3R,4S,5R,6R)-6-(acetyloxymethyl)-3,4,5-tris(2-methylpropanoyloxy)oxan-2-yl]oxy-3,4-bis(2-methylpropanoyloxy)oxolan-2-yl]methyl 2-methylpropanoate |
InChI | InChI=1S/C40H62O19/c1-18(2)33(43)51-17-40(32(57-38(48)23(11)12)29(54-35(45)20(5)6)27(58-40)16-50-25(14)42)59-39-31(56-37(47)22(9)10)30(55-36(46)21(7)8)28(53-34(44)19(3)4)26(52-39)15-49-24(13)41/h18-23,26-32,39H,15-17H2,1-14H3/t26-,27-,28-,29-,30+,31-,32+,39-,40+/m1/s1 |
InChIKey | ZNEBZIJCDDCNRC-SWTLDUCYSA-N |
SMILES | CC(C)C(=O)OCC1(C(C(C(O1)COC(=O)C)OC(=O)C(C)C)OC(=O)C(C)C)OC2C(C(C(C(O2)COC(=O)C)OC(=O)C(C)C)OC(=O)C(C)C)OC(=O)C(C)C |