For research use only. Not for therapeutic Use.
Sucrose monostearate(CAT: R071343) is a sucrose ester compound used as an emulsifier and stabilizer in the food and pharmaceutical industries. In food products, it enhances texture and stability, preventing ingredient separation in items such as baked goods, confections, ice creams, and salad dressings. In pharmaceutical formulations, it improves the solubility and bioavailability of certain active ingredients. Additionally, sucrose monostearate finds application in cosmetics for its emulsifying and stabilizing properties, making it a versatile and valuable ingredient in various consumer products.
Catalog Number | R071343 |
CAS Number | 25168-73-4 |
Synonyms | Crodesta F-160 |
Molecular Formula | C30H56O12 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | [(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-2-yl]methyl octadecanoate |
InChI | InChI=1S/C30H56O12/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(33)39-20-30(28(38)25(35)22(19-32)41-30)42-29-27(37)26(36)24(34)21(18-31)40-29/h21-22,24-29,31-32,34-38H,2-20H2,1H3/t21-,22-,24-,25-,26+,27-,28+,29-,30+/m1/s1 |
InChIKey | SZYSLWCAWVWFLT-UTGHZIEOSA-N |
SMILES | CCCCCCCCCCCCCCCCCC(=O)OCC1(C(C(C(O1)CO)O)O)OC2C(C(C(C(O2)CO)O)O)O |