Sudan Blue (Cat.No:M070347) is a synthetic dye commonly used for staining fats and lipids in histology and microscopy. It has an affinity for lipophilic substances, making it useful in identifying lipid-rich structures within cells and tissues. Sudan Blue staining aids in visualizing cellular lipid content and distribution, aiding in various research applications.
| Catalog Number | M070347 |
| CAS Number | 128-85-8 |
| Molecular Formula | C22H18N2O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-(methylamino)-4-(4-methylanilino)anthracene-9,10-dione |
| InChI | InChI=1S/C22H18N2O2/c1-13-7-9-14(10-8-13)24-18-12-11-17(23-2)19-20(18)22(26)16-6-4-3-5-15(16)21(19)25/h3-12,23-24H,1-2H3 |
| InChIKey | ITYXXSSJBOAGAR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=C3C(=C(C=C2)NC)C(=O)C4=CC=CC=C4C3=O |
