For research use only. Not for therapeutic Use.
Sudan I-d5 (Cat.No:R048608) is a deuterated form of Sudan I, a synthetic dye previously used in the textile and food industries. Deuterated Sudan I is a stable isotope-labeled compound, often employed as an internal standard in analytical chemistry and toxicology studies to accurately quantify Sudan I levels in various samples.
| Catalog Number | R048608 |
| CAS Number | 752211-63-5 |
| Synonyms | 1-(2-Phenyldiazenyl-d5)-2-naphthalenol; 1-9Phenyl-d5)azo-2-naphthol; C.I. Solvent Yellow 14-d5; Sudan Yellow-d5; 1-(2-Hydroxynaphthyl)azobenzene-d5; 1-(Phenylazo-d5)-2-hydroxynaphthalene; 1-(Phenylazo-d5)-2-naphthol; 1-(Benzeneazo-d5)-2-naphthol; Fas |
| Molecular Formula | C16H12N2O |
| Purity | ≥95% |
| Target | Bacterial |
| Storage | -20°C |
| IUPAC Name | (1Z)-1-[(2,3,4,5,6-pentadeuteriophenyl)hydrazinylidene]naphthalen-2-one |
| InChI | InChI=1S/C16H12N2O/c19-15-11-10-12-6-4-5-9-14(12)16(15)18-17-13-7-2-1-3-8-13/h1-11,17H/b18-16-/i1D,2D,3D,7D,8D |
| InChIKey | ZONYAPYTDIVJGG-RMKIHZJYSA-N |
| SMILES | C1=CC=C(C=C1)NN=C2C(=O)C=CC3=CC=CC=C32 |
