For research use only. Not for therapeutic Use.
Sudan III-d6(Cat No.:S000473) is a deuterated version of Sudan III, where six hydrogen atoms are replaced with deuterium, enhancing its stability for research use. Sudan III is a lysochrome (fat-soluble dye), commonly used in biological staining to highlight lipids in tissues, indicating the presence of triglycerides and lipoproteins. This dye is particularly significant in histology for staining fat in cells, helping to identify changes in tissue composition. The deuterated version, Sudan III-d6, is valuable in analytical chemistry and research, providing insights into the dye’s behavior and stability under various conditions.
CAS Number | 1014689-17-8 |
Molecular Formula | C22H10D6N4O |
Purity | ≥95% |
IUPAC Name | (1Z)-3,4,5,6,7,8-hexadeuterio-1-[(4-phenyldiazenylphenyl)hydrazinylidene]naphthalen-2-one |
InChI | InChI=1S/C22H16N4O/c27-21-15-10-16-6-4-5-9-20(16)22(21)26-25-19-13-11-18(12-14-19)24-23-17-7-2-1-3-8-17/h1-15,25H/b24-23?,26-22-/i4D,5D,6D,9D,10D,15D |
InChIKey | HTPQPMPFXUWUOT-OJPXFQCRSA-N |
SMILES | C1=CC=C(C=C1)N=NC2=CC=C(C=C2)NN=C3C(=O)C=CC4=CC=CC=C43 |